Compound Q&A

What industries use 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

Answer

5-Nitro-2-pyridinecarboxylic acid
5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) is used in the pharmaceutical industry for the synthesis of drugs, particularly those targeting specific proteins or enzymes. It also finds applications in the polymer industry for the modification of polymers and in the semiconductor industry for the production of electronic components.

About

CAS No 30651-24-2
English Name 5-Nitro-2-pyridinecarboxylic acid
Molecular Formula C6H4N2O4
Molecular Weight 168.11 g/mol
SMILES C1=CC(=NC=C1[N+](=O)[O-])C(=O)O
InChIKey QKYRCTVBMNXTBT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) typically synthesized?

5-Nitro-2-pyridinecarboxylic acid can be synthesized by nitration of 2-pyridinecarboxylic acid. The ...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

Handling 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) requires proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...