Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

Answer

5-Nitro-2-pyridinecarboxylic acid
5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) is a crystalline solid with a molecular weight of 193.10 g/mol. It is slightly soluble in water and polar organic solvents. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It also displays acidity due to the carboxylic acid group.

About

CAS No 30651-24-2
English Name 5-Nitro-2-pyridinecarboxylic acid
Molecular Formula C6H4N2O4
Molecular Weight 168.11 g/mol
SMILES C1=CC(=NC=C1[N+](=O)[O-])C(=O)O
InChIKey QKYRCTVBMNXTBT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) typically synthesized?

5-Nitro-2-pyridinecarboxylic acid can be synthesized by nitration of 2-pyridinecarboxylic acid. The ...

Compound Q&A

What industries use 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

Handling 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) requires proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...