Compound Q&A

How is 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) typically synthesized?

Answer

5-Nitro-2-pyridinecarboxylic acid
5-Nitro-2-pyridinecarboxylic acid can be synthesized by nitration of 2-pyridinecarboxylic acid. The process involves treating the acid with a nitronium salt in the presence of a suitable solvent. Subsequent purification steps include recrystallization from water or an appropriate organic solvent to obtain the desired pure compound.

About

CAS No 30651-24-2
English Name 5-Nitro-2-pyridinecarboxylic acid
Molecular Formula C6H4N2O4
Molecular Weight 168.11 g/mol
SMILES C1=CC(=NC=C1[N+](=O)[O-])C(=O)O
InChIKey QKYRCTVBMNXTBT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2)?

Handling 5-Nitro-2-pyridinecarboxylic acid (CAS: 30651-24-2) requires proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...