Compound Q&A

What industries use 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

Answer

4-Benzoylphenyl acrylate
4-Benzoylphenyl acrylate is used in various industries. It is a key intermediate in the production of polymers and adhesives, where it contributes to the development of high-performance materials with improved mechanical properties. Additionally, it has applications in the pharmaceutical industry for synthesizing certain types of drugs, and it can also be used in the formulation of certain sensors and semiconductors.

About

CAS No 22535-49-5
English Name 4-Benzoylphenyl acrylate
Molecular Formula C16H12O3
Molecular Weight 252.27 g/mol
SMILES C=CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2
InChIKey LTYBJDPMCPTGEE-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

4-Benzoylphenyl acrylate (CAS: 22535-49-5) is a clear, colorless to slightly yellow liquid at room t...

Compound Q&A

How is 4-Benzoylphenyl acrylate (CAS: 22535-49-5) typically synthesized?

4-Benzoylphenyl acrylate is typically synthesized through the condensation of benzoyl chloride with ...

Compound Q&A

What precautions should be taken when handling 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

When handling 4-Benzoylphenyl acrylate (CAS: 22535-49-5), it is crucial to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...