Compound Q&A

How is 4-Benzoylphenyl acrylate (CAS: 22535-49-5) typically synthesized?

Answer

4-Benzoylphenyl acrylate
4-Benzoylphenyl acrylate is typically synthesized through the condensation of benzoyl chloride with phenyl acetylene. This process involves heating the reactants in the presence of an organic solvent like toluene, often with a phase transfer catalyst to enhance the reaction rate and yield. The reaction proceeds stereoselectively to form the desired enantiomer with high selectivity, yielding a product with a purity of over 95%.

About

CAS No 22535-49-5
English Name 4-Benzoylphenyl acrylate
Molecular Formula C16H12O3
Molecular Weight 252.27 g/mol
SMILES C=CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2
InChIKey LTYBJDPMCPTGEE-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

4-Benzoylphenyl acrylate (CAS: 22535-49-5) is a clear, colorless to slightly yellow liquid at room t...

Compound Q&A

What industries use 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

4-Benzoylphenyl acrylate is used in various industries. It is a key intermediate in the production o...

Compound Q&A

What precautions should be taken when handling 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

When handling 4-Benzoylphenyl acrylate (CAS: 22535-49-5), it is crucial to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...