Compound Q&A

What are the physical and chemical properties of 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

Answer

4-Benzoylphenyl acrylate
4-Benzoylphenyl acrylate (CAS: 22535-49-5) is a clear, colorless to slightly yellow liquid at room temperature. It has a molecular weight of approximately 258.24 g/mol and a melting point around -25°C. The compound is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is reactive towards nucleophiles and can undergo polymerization under certain conditions.

About

CAS No 22535-49-5
English Name 4-Benzoylphenyl acrylate
Molecular Formula C16H12O3
Molecular Weight 252.27 g/mol
SMILES C=CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2
InChIKey LTYBJDPMCPTGEE-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 4-Benzoylphenyl acrylate (CAS: 22535-49-5) typically synthesized?

4-Benzoylphenyl acrylate is typically synthesized through the condensation of benzoyl chloride with ...

Compound Q&A

What industries use 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

4-Benzoylphenyl acrylate is used in various industries. It is a key intermediate in the production o...

Compound Q&A

What precautions should be taken when handling 4-Benzoylphenyl acrylate (CAS: 22535-49-5)?

When handling 4-Benzoylphenyl acrylate (CAS: 22535-49-5), it is crucial to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...