Compound Q&A

What industries use N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

Answer

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (1:1)
N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is used in the pharmaceutical industry for the synthesis of certain drugs due to its reactivity and stability. It is also employed in the polymer industry for the modification of polymers and in the production of sensors and semiconductors. Its specific applications include the preparation of bioactive compounds, drug intermediates, and functional materials.

About

CAS No 63-92-3
English Name N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (1:1)
Molecular Formula C18H23Cl2NO
Molecular Weight 340.29 g/mol
SMILES CC(COC1=CC=CC=C1)N(CCCl)CC2=CC=CC=C2.Cl
InChIKey VBCPVIWPDJVHAN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is a white crystalline solid with a...

Compound Q&A

How is N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3) typically synthesized?

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is typically synthesized through a ...

Compound Q&A

What precautions should be taken when handling N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

When handling N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...