Compound Q&A

How is N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3) typically synthesized?

Answer

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (1:1)
N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is typically synthesized through a multi-step process involving the reaction of phenoxyacetic acid, benzylamine, and 2-chloroethanol. The process involves esterification, amidation, and substitution reactions. The reaction is catalyzed by an acid or base, and the final step involves the protonation of the amine to form the hydrochloride salt. The yield is typically around 75-85%, with high selectivity towards the target product.

About

CAS No 63-92-3
English Name N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (1:1)
Molecular Formula C18H23Cl2NO
Molecular Weight 340.29 g/mol
SMILES CC(COC1=CC=CC=C1)N(CCCl)CC2=CC=CC=C2.Cl
InChIKey VBCPVIWPDJVHAN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is a white crystalline solid with a...

Compound Q&A

What industries use N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

When handling N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...