Compound Q&A

What are the physical and chemical properties of N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

Answer

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (1:1)
N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is a white crystalline solid with a molecular weight of approximately 369.95 g/mol. It is slightly soluble in water and ethanol. The compound is known for its reactivity in nucleophilic substitution reactions and is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight. Its solubility and reactivity make it suitable for use in various chemical processes.

About

CAS No 63-92-3
English Name N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (1:1)
Molecular Formula C18H23Cl2NO
Molecular Weight 340.29 g/mol
SMILES CC(COC1=CC=CC=C1)N(CCCl)CC2=CC=CC=C2.Cl
InChIKey VBCPVIWPDJVHAN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3) typically synthesized?

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is typically synthesized through a ...

Compound Q&A

What industries use N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride (CAS: 63-92-3)?

When handling N-Benzyl-N-(2-chloroethyl)-1-phenoxy-2-propanamine hydrochloride, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...