Compound Q&A

What industries use Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

Answer

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate
Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is primarily used in the pharmaceutical industry for the development of novel drug candidates due to its unique chemical structure. It is also utilized in the research and development of new materials for sensors and semiconductors, where its specific properties may offer advantages in sensitive detection and electronic applications.

About

English Name Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate
Molecular Formula C17H13NO4
Molecular Weight 295.29 g/mol
SMILES COC(=O)c1c(c2ccc(cc2cn1)Oc3ccccc3)O
InChIKey YTWDBRIDKWWANA-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is a crystalline compound w...

Compound Q&A

How is Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) typically synthesized?

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is typically synthesized th...

Compound Q&A

What precautions should be taken when handling Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

When handling Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...