Compound Q&A

How is Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) typically synthesized?

Answer

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate
Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is typically synthesized through a multi-step reaction sequence involving the condensation of a phenoxy derivative with an isoquinoline carboxylic acid. This process often uses a Lewis acid catalyst, such as aluminum chloride, to facilitate the nucleophilic substitution reaction. The final product is obtained with good selectivity and yield, typically around 80%. This compound is often prepared in a laboratory setting for further chemical modification or analysis.

About

English Name Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate
Molecular Formula C17H13NO4
Molecular Weight 295.29 g/mol
SMILES COC(=O)c1c(c2ccc(cc2cn1)Oc3ccccc3)O
InChIKey YTWDBRIDKWWANA-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is a crystalline compound w...

Compound Q&A

What industries use Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

When handling Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...