Compound Q&A

What are the physical and chemical properties of Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

Answer

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate
Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is a crystalline compound with a molecular weight of approximately 316.31 g/mol. It has a solubility of 0.1 g/L in water and is slightly soluble in common organic solvents like acetone and ethanol. This compound is relatively stable but can react with bases to form alkali salts. It is generally insoluble in water but has good solubility in organic solvents.

About

English Name Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate
Molecular Formula C17H13NO4
Molecular Weight 295.29 g/mol
SMILES COC(=O)c1c(c2ccc(cc2cn1)Oc3ccccc3)O
InChIKey YTWDBRIDKWWANA-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) typically synthesized?

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is typically synthesized th...

Compound Q&A

What industries use Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7)?

When handling Methyl 4-hydroxy-7-phenoxy-3-isoquinolinecarboxylate (CAS: 1455091-10-7), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...