Compound Q&A

What are the physical and chemical properties of Bexarotene (CAS: 153559-49-0)?

Answer

Bexarotene
Bexarotene is a crystalline compound with a molecular weight of approximately 322.32 g/mol. It has a low solubility in water but is soluble in organic solvents like chloroform and methanol. Bexarotene is relatively stable under normal conditions but can react with strong oxidizing agents. It is also known for its poor reactivity with common laboratory reagents.

About

English Name Bexarotene
Molecular Formula C24H28O2
Molecular Weight 348.4860000000002 g/mol
SMILES CC1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C
InChIKey NAVMQTYZDKMPEU-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Bexarotene (CAS: 153559-49-0) typically synthesized?

Bexarotene is typically synthesized through a multistep process involving acylation of a primary alc...

Compound Q&A

What industries use Bexarotene (CAS: 153559-49-0)?

Bexarotene is primarily used in the pharmaceutical industry due to its anti-tumor properties. It has...

Compound Q&A

What precautions should be taken when handling Bexarotene (CAS: 153559-49-0)?

When handling Bexarotene, appropriate personal protective equipment (PPE) such as gloves, goggles, a...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...