Compound Q&A

What precautions should be taken when handling 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

Answer

5-Amino-1-naphthalenesulfonic acid
When handling 5-Amino-1-naphthalenesulfonic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work should be conducted in a fume hood due to its reactivity. Spills should be cleaned up carefully, and proper safety data sheets (SDS) should be consulted for detailed instructions on disposal and emergency procedures.

About

CAS No 84-89-9
English Name 5-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)N
InChIKey DQNAQOYOSRJXFZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

5-Amino-1-naphthalenesulfonic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9) typically synthesized?

5-Amino-1-naphthalenesulfonic acid is commonly synthesized through the sulfonation of 1-naphthol fol...

Compound Q&A

What industries use 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

5-Amino-1-naphthalenesulfonic acid finds applications in various industries, including the pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...