Compound Q&A

What industries use 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

Answer

5-Amino-1-naphthalenesulfonic acid
5-Amino-1-naphthalenesulfonic acid finds applications in various industries, including the pharmaceutical sector for drug synthesis, polymer production for its coloring properties, and sensor technology for analytical purposes. It is also used in semiconductor manufacturing for etching and polishing processes.

About

CAS No 84-89-9
English Name 5-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)N
InChIKey DQNAQOYOSRJXFZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

5-Amino-1-naphthalenesulfonic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9) typically synthesized?

5-Amino-1-naphthalenesulfonic acid is commonly synthesized through the sulfonation of 1-naphthol fol...

Compound Q&A

What precautions should be taken when handling 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

When handling 5-Amino-1-naphthalenesulfonic acid, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...