Compound Q&A

How is 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9) typically synthesized?

Answer

5-Amino-1-naphthalenesulfonic acid
5-Amino-1-naphthalenesulfonic acid is commonly synthesized through the sulfonation of 1-naphthol followed by reduction of the sulfonic acid group. This process typically involves the use of sulfur trioxide in pyridine and subsequent reduction with sodium borohydride or hydrogen gas over a catalyst like palladium on carbon.

About

CAS No 84-89-9
English Name 5-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)N
InChIKey DQNAQOYOSRJXFZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

5-Amino-1-naphthalenesulfonic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

What industries use 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

5-Amino-1-naphthalenesulfonic acid finds applications in various industries, including the pharmaceu...

Compound Q&A

What precautions should be taken when handling 5-Amino-1-naphthalenesulfonic acid (CAS: 84-89-9)?

When handling 5-Amino-1-naphthalenesulfonic acid, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...