Compound Q&A

How is (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4) typically synthesized?

Answer

(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate
(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate is usually synthesized via a multistep process involving fluorocyclopropanamine and 4-methylbenzenesulfonyl chloride. The reaction is typically carried out in the presence of a base, such as triethylamine, under anhydrous conditions. The yield and selectivity can be optimized using specific catalysts and reaction conditions, making it a valuable intermediate in organic synthesis.

About

English Name (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate
Molecular Formula C10H14FNO3S
Molecular Weight 247.29 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.C1C(C1F)N
InChIKey XUWZMHVPMZXIRU-LMLSDSMGSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4)?

(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate has a crystalline form with a molecular ...

Compound Q&A

What industries use (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4)?

(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate is primarily used in pharmaceuticals and...

Compound Q&A

What precautions should be taken when handling (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4)?

When handling (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate, it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...