Compound Q&A

What are the physical and chemical properties of (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4)?

Answer

(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate
(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate has a crystalline form with a molecular weight of approximately 269.2 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. The compound is known for its stability under neutral conditions but can be reactive in acidic or strongly basic environments. It is typically used in organic synthesis and pharmaceutical applications due to its unique chemical structure.

About

English Name (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate
Molecular Formula C10H14FNO3S
Molecular Weight 247.29 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.C1C(C1F)N
InChIKey XUWZMHVPMZXIRU-LMLSDSMGSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4) typically synthesized?

(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate is usually synthesized via a multistep p...

Compound Q&A

What industries use (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4)?

(1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate is primarily used in pharmaceuticals and...

Compound Q&A

What precautions should be taken when handling (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate (CAS: 143062-84-4)?

When handling (1R,2S)-2-Fluorocyclopropanaminium 4-methylbenzenesulfonate, it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...