Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

Answer

2,4-Dichloro-5-nitropyrimidine
When handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2), it is crucial to wear proper personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be handled carefully using appropriate absorbents, and the material safety data sheet (MSDS) or safety data sheet (SDS) should be consulted for detailed handling instructions. Storage should be in a cool, dry place away from heat and ignition sources.

About

CAS No 49845-33-2
English Name 2,4-Dichloro-5-nitropyrimidine
Molecular Formula C4HCl2N3O2
Molecular Weight 193.97 g/mol
SMILES C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-]
InChIKey INUSQTPGSHFGHM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) typically synthesized?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is usually synthesized by the nitration of 2,4-dich...

Compound Q&A

What industries use 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is used in various industries, particularly in phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...