Compound Q&A

What industries use 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

Answer

2,4-Dichloro-5-nitropyrimidine
2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is used in various industries, particularly in pharmaceuticals for the synthesis of certain drugs. It is also used in the production of specialty chemicals, as a precursor in the polymer industry, and in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 49845-33-2
English Name 2,4-Dichloro-5-nitropyrimidine
Molecular Formula C4HCl2N3O2
Molecular Weight 193.97 g/mol
SMILES C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-]
InChIKey INUSQTPGSHFGHM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) typically synthesized?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is usually synthesized by the nitration of 2,4-dich...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

When handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2), it is crucial to wear proper persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...