Compound Q&A

What industries use 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

Answer

2,4-Dichloro-5-nitropyrimidine
2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is used in various industries, particularly in pharmaceuticals for the synthesis of certain drugs. It is also used in the production of specialty chemicals, as a precursor in the polymer industry, and in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 49845-33-2
English Name 2,4-Dichloro-5-nitropyrimidine
Molecular Formula C4HCl2N3O2
Molecular Weight 193.97 g/mol
SMILES C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-]
InChIKey INUSQTPGSHFGHM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) typically synthesized?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is usually synthesized by the nitration of 2,4-dich...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

When handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2), it is crucial to wear proper persona...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...