Compound Q&A

How is 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) typically synthesized?

Answer

2,4-Dichloro-5-nitropyrimidine
2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is usually synthesized by the nitration of 2,4-dichloropyrimidine. The reaction is typically carried out using concentrated nitric acid under carefully controlled conditions. The process requires strict temperature and concentration control to achieve the desired yield and selectivity. The reaction mixture is then purified by recrystallization to obtain the pure compound.

About

CAS No 49845-33-2
English Name 2,4-Dichloro-5-nitropyrimidine
Molecular Formula C4HCl2N3O2
Molecular Weight 193.97 g/mol
SMILES C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-]
InChIKey INUSQTPGSHFGHM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is a crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2) is used in various industries, particularly in phar...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2)?

When handling 2,4-Dichloro-5-nitropyrimidine (CAS: 49845-33-2), it is crucial to wear proper persona...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...