Compound Q&A

How is 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7) typically synthesized?

Answer

5-bromo-3-nitro-pyridin-2-ol
5-bromo-3-nitro-pyridin-2-ol is commonly synthesized via the nitration of 5-bromo-pyridin-2-ol followed by bromination. The nitration step uses nitric acid and sulfuric acid as the oxidizing agent, while the bromination uses bromine in carbon tetrachloride or another inert solvent. The process typically yields a high purity product with good selectivity.

About

CAS No 15862-34-7
English Name 5-bromo-3-nitro-pyridin-2-ol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=C(C(=O)NC=C1Br)[N+](=O)[O-]
InChIKey WXRLCVUDLFFTFF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7)?

5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7)?

5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7) is used in various industries including pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7)?

When handling 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7), it is essential to wear proper persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...