Compound Q&A

What are the physical and chemical properties of 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7)?

Answer

5-bromo-3-nitro-pyridin-2-ol
5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7) is a crystalline solid with a molecular weight of approximately 221.04 g/mol. It has a high solubility in aqueous solutions and is known for its reactivity, particularly with reducing agents and nucleophiles. It can undergo substitution and nitration reactions with high selectivity and good yields.

About

CAS No 15862-34-7
English Name 5-bromo-3-nitro-pyridin-2-ol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=C(C(=O)NC=C1Br)[N+](=O)[O-]
InChIKey WXRLCVUDLFFTFF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7) typically synthesized?

5-bromo-3-nitro-pyridin-2-ol is commonly synthesized via the nitration of 5-bromo-pyridin-2-ol follo...

Compound Q&A

What industries use 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7)?

5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7) is used in various industries including pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7)?

When handling 5-bromo-3-nitro-pyridin-2-ol (CAS: 15862-34-7), it is essential to wear proper persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...