Compound Q&A

What precautions should be taken when handling 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

Answer

3-Chloro-2-nitrobenzoic acid
When handling 3-Chloro-2-nitrobenzoic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. It should be handled in a fume hood to minimize inhalation risks. Spills should be immediately neutralized with an appropriate base before cleaning up. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 4771-47-5
English Name 3-Chloro-2-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C(=O)O
InChIKey VCHSXYHBMFKRBK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

3-Chloro-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 215.03 ...

Compound Q&A

How is 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5) typically synthesized?

3-Chloro-2-nitrobenzoic acid can be synthesized through the nitration of 3-chlorobenzoic acid follow...

Compound Q&A

What industries use 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

3-Chloro-2-nitrobenzoic acid is used in the pharmaceutical industry as an intermediate for the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...