Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

Answer

3-Chloro-2-nitrobenzoic acid
3-Chloro-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 215.03 g/mol. It has a melting point of 249-252°C. The compound is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It is chemically reactive, particularly with bases and reducing agents, due to the presence of both nitro and chlorine functional groups.

About

CAS No 4771-47-5
English Name 3-Chloro-2-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C(=O)O
InChIKey VCHSXYHBMFKRBK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5) typically synthesized?

3-Chloro-2-nitrobenzoic acid can be synthesized through the nitration of 3-chlorobenzoic acid follow...

Compound Q&A

What industries use 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

3-Chloro-2-nitrobenzoic acid is used in the pharmaceutical industry as an intermediate for the synth...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

When handling 3-Chloro-2-nitrobenzoic acid, it is crucial to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...