Compound Q&A

How is 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5) typically synthesized?

Answer

3-Chloro-2-nitrobenzoic acid
3-Chloro-2-nitrobenzoic acid can be synthesized through the nitration of 3-chlorobenzoic acid followed by acetylation and hydrolysis. The nitration step involves the reaction of 3-chlorobenzoic acid with nitric acid in the presence of a sulfuric acid catalyst. The yield is typically around 70-80%, and the product can be purified by recrystallization.

About

CAS No 4771-47-5
English Name 3-Chloro-2-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])C(=O)O
InChIKey VCHSXYHBMFKRBK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

3-Chloro-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 215.03 ...

Compound Q&A

What industries use 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

3-Chloro-2-nitrobenzoic acid is used in the pharmaceutical industry as an intermediate for the synth...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-nitrobenzoic acid (CAS: 4771-47-5)?

When handling 3-Chloro-2-nitrobenzoic acid, it is crucial to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...