Compound Q&A

What precautions should be taken when handling 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

Answer

4-(Trifluoromethyl)benzoyl chloride
When handling 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Use a fume hood to minimize exposure. Spills should be cleaned up carefully with absorbent materials and neutralized with a base. For detailed safety information, refer to the Safety Data Sheet (SDS). Storage should be in a cool, dry place, away from incompatible materials, and tightly sealed to prevent hydrolysis and evaporation.

About

CAS No 329-15-7
English Name 4-(Trifluoromethyl)benzoyl chloride
Molecular Formula C8H4ClF3O
Molecular Weight 208.57 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)C(F)(F)F
InChIKey OXZYBOLWRXENKT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) is a colorless to pale yellow liquid with a mole...

Compound Q&A

How is 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) typically synthesized?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) can be synthesized by the reaction of 4-(trifluo...

Compound Q&A

What industries use 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) is primarily used in the pharmaceutical and poly...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...