Compound Q&A

What are the physical and chemical properties of 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

Answer

4-(Trifluoromethyl)benzoyl chloride
4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) is a colorless to pale yellow liquid with a molecular weight of 275.05 g/mol. It has a high boiling point (159-161°C) and low solubility in water (0.2 g/L). The compound is highly reactive, particularly towards nucleophiles, and is prone to hydrolysis under basic conditions. It crystallizes in the monoclinic system and is used in organic synthesis for its electrophilic aromatic character.

About

CAS No 329-15-7
English Name 4-(Trifluoromethyl)benzoyl chloride
Molecular Formula C8H4ClF3O
Molecular Weight 208.57 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)C(F)(F)F
InChIKey OXZYBOLWRXENKT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) typically synthesized?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) can be synthesized by the reaction of 4-(trifluo...

Compound Q&A

What industries use 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) is primarily used in the pharmaceutical and poly...

Compound Q&A

What precautions should be taken when handling 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

When handling 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...