Compound Q&A

What industries use 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

Answer

4-(Trifluoromethyl)benzoyl chloride
4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) is primarily used in the pharmaceutical and polymer industries for the synthesis of complex organic compounds. It serves as a key intermediate in the production of drugs, functional polymers, and materials with specific electronic properties. The compound is also utilized in the semiconductor industry for creating specialized coatings and in the production of sensors.

About

CAS No 329-15-7
English Name 4-(Trifluoromethyl)benzoyl chloride
Molecular Formula C8H4ClF3O
Molecular Weight 208.57 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)C(F)(F)F
InChIKey OXZYBOLWRXENKT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) is a colorless to pale yellow liquid with a mole...

Compound Q&A

How is 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) typically synthesized?

4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7) can be synthesized by the reaction of 4-(trifluo...

Compound Q&A

What precautions should be taken when handling 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7)?

When handling 4-(Trifluoromethyl)benzoyl chloride (CAS: 329-15-7), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...