Compound Q&A

What industries use Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4)?

Answer

Acetylsalicylic Acid EP Impurity B (Salicylic Acid USP Related Compound B)
Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) is primarily used in the pharmaceutical industry as a quality control and impurity reference material. It is also relevant in the analytical chemistry sector for the development and validation of analytical methods. Additionally, it may be used in research and development for studying the behavior of related compounds in various chemical processes.

About

CAS No 636-46-4
English Name Acetylsalicylic Acid EP Impurity B (Salicylic Acid USP Related Compound B)
Molecular Formula C8H6O5
Molecular Weight 182.13 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)C(=O)O)O
InChIKey BCEQKAQCUWUNML-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4)?

Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) is a white crystalline solid with a molecular wei...

Compound Q&A

How is Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) typically synthesized?

Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) is typically synthesized through the acetylation ...

Compound Q&A

What precautions should be taken when handling Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4)?

When handling Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...