Compound Q&A

How is Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) typically synthesized?

Answer

Acetylsalicylic Acid EP Impurity B (Salicylic Acid USP Related Compound B)
Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) is typically synthesized through the acetylation of salicylic acid under controlled conditions. The process involves the reaction of salicylic acid with acetic anhydride in the presence of a catalyst, such as concentrated sulfuric acid, at a specific temperature. The yield varies depending on the purity of the starting materials and the reaction conditions.

About

CAS No 636-46-4
English Name Acetylsalicylic Acid EP Impurity B (Salicylic Acid USP Related Compound B)
Molecular Formula C8H6O5
Molecular Weight 182.13 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)C(=O)O)O
InChIKey BCEQKAQCUWUNML-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4)?

Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) is a white crystalline solid with a molecular wei...

Compound Q&A

What industries use Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4)?

Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4)?

When handling Acetylsalicylic Acid EP Impurity B (CAS: 636-46-4), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...