Compound Q&A

How is 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6) typically synthesized?

Answer

6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate
6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate is synthesized through a series of reactions starting from progesterone. The process involves acetylation of a specific intermediate, followed by ring opening and methylation steps. Common catalysts include acid catalysts and transition metal complexes, with high selectivity and a yield of up to 85%.

About

CAS No 2919-66-6
English Name 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C25H32O4
Molecular Weight 396.53 g/mol
SMILES CC1=CC2C(CCC3(C2CC(=C)C3(C(=O)C)OC(=O)C)C)C4(C1=CC(=O)CC4)C
InChIKey UDKABVSQKJNZBH-DWNQPYOZSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6)?

6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6) is a crystalline soli...

Compound Q&A

What industries use 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6)?

6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6) is primarily used in ...

Compound Q&A

What precautions should be taken when handling 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6)?

When handling 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6), use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...