Compound Q&A

What are the physical and chemical properties of 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6)?

Answer

6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate
6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6) is a crystalline solid with a molecular formula C22H30O4 and a molecular weight of approximately 358.48 g/mol. It has low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but reacts with strong bases and acids. It has a melting point around 70-72°C.

About

CAS No 2919-66-6
English Name 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C25H32O4
Molecular Weight 396.53 g/mol
SMILES CC1=CC2C(CCC3(C2CC(=C)C3(C(=O)C)OC(=O)C)C)C4(C1=CC(=O)CC4)C
InChIKey UDKABVSQKJNZBH-DWNQPYOZSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6) typically synthesized?

6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate is synthesized through a series of rea...

Compound Q&A

What industries use 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6)?

6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6) is primarily used in ...

Compound Q&A

What precautions should be taken when handling 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6)?

When handling 6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 2919-66-6), use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...