Compound Q&A

What are the physical and chemical properties of 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS: 117724-63-7)?

Answer

2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is a crystalline solid with a molecular weight of 269.97 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetonitrile. It is a weak acid with limited reactivity under normal conditions. This compound is stable under acidic and basic conditions but can be sensitive to strong oxidizing agents.

About

English Name 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
Molecular Formula C6H4F3NO2S
Molecular Weight 211.16 g/mol
SMILES CC1=NC(=C(S1)C(=O)O)C(F)(F)F
InChIKey REKJPVUFKQYMHW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS: 117724-63-7) typically synthesized?

2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is typically synthesized via the reactio...

Compound Q&A

What industries use 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS: 117724-63-7)?

2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is used in the pharmaceutical industry a...

Compound Q&A

What precautions should be taken when handling 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS: 117724-63-7)?

When handling 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, it is important to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...