Compound Q&A

What are the physical and chemical properties of 3-Methoxy-N-phenylaniline (CAS: 101-16-6)?

Answer

3-Methoxy-N-phenylaniline
3-Methoxy-N-phenylaniline (CAS: 101-16-6) is a white crystalline solid with a molecular weight of approximately 194.21 g/mol. It has a solubility of about 2.4 g/L in water and is slightly soluble in organic solvents such as ethanol. Chemically, it is relatively stable but can react with strong oxidizing agents. It exhibits a molar absorptivity of 10,000 M^-1 cm^-1 in the UV region, making it useful for analytical chemistry applications.

About

CAS No 101-16-6
English Name 3-Methoxy-N-phenylaniline
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES COC1=CC=CC(=C1)NC2=CC=CC=C2
InChIKey MKASXAGBWHIGCF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3-Methoxy-N-phenylaniline (CAS: 101-16-6) typically synthesized?

3-Methoxy-N-phenylaniline (CAS: 101-16-6) is typically synthesized via a condensation reaction betwe...

Compound Q&A

What industries use 3-Methoxy-N-phenylaniline (CAS: 101-16-6)?

3-Methoxy-N-phenylaniline (CAS: 101-16-6) is used in various industries, including pharmaceuticals f...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-N-phenylaniline (CAS: 101-16-6)?

When handling 3-Methoxy-N-phenylaniline (CAS: 101-16-6), it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...