Compound Q&A

What industries use Octafluoronaphthalene (CAS: 313-72-4)?

Answer

Octafluoronaphthalene
Octafluoronaphthalene (CAS: 313-72-4) is used in various industries, including pharmaceuticals for the synthesis of certain fluorinated compounds, polymers for specialty applications, and sensors for detecting organic compounds. It is also utilized in the development of semiconductors and as a precursor in fluorination chemistry.

About

CAS No 313-72-4
English Name Octafluoronaphthalene
Molecular Formula C10F8
Molecular Weight 272.09 g/mol
SMILES C12=C(C(=C(C(=C1F)F)F)F)C(=C(C(=C2F)F)F)F
InChIKey JDCMOHAFGDQQJX-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Octafluoronaphthalene (CAS: 313-72-4)?

Octafluoronaphthalene (CAS: 313-72-4) is a stable, colorless crystalline solid with a high melting p...

Compound Q&A

How is Octafluoronaphthalene (CAS: 313-72-4) typically synthesized?

Octafluoronaphthalene is typically synthesized through the fluorination of naphthalene using fluorin...

Compound Q&A

What precautions should be taken when handling Octafluoronaphthalene (CAS: 313-72-4)?

When handling Octafluoronaphthalene (CAS: 313-72-4), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...