Compound Q&A

What are the physical and chemical properties of Octafluoronaphthalene (CAS: 313-72-4)?

Answer

Octafluoronaphthalene
Octafluoronaphthalene (CAS: 313-72-4) is a stable, colorless crystalline solid with a high melting point and low solubility in water. Its molecular weight is approximately 254.04 g/mol. It is not highly reactive under normal conditions but can be susceptible to thermal decomposition. It is insoluble in water but soluble in organic solvents like dichloromethane and chloroform.

About

CAS No 313-72-4
English Name Octafluoronaphthalene
Molecular Formula C10F8
Molecular Weight 272.09 g/mol
SMILES C12=C(C(=C(C(=C1F)F)F)F)C(=C(C(=C2F)F)F)F
InChIKey JDCMOHAFGDQQJX-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Octafluoronaphthalene (CAS: 313-72-4) typically synthesized?

Octafluoronaphthalene is typically synthesized through the fluorination of naphthalene using fluorin...

Compound Q&A

What industries use Octafluoronaphthalene (CAS: 313-72-4)?

Octafluoronaphthalene (CAS: 313-72-4) is used in various industries, including pharmaceuticals for t...

Compound Q&A

What precautions should be taken when handling Octafluoronaphthalene (CAS: 313-72-4)?

When handling Octafluoronaphthalene (CAS: 313-72-4), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...