Compound Q&A

How is Octafluoronaphthalene (CAS: 313-72-4) typically synthesized?

Answer

Octafluoronaphthalene
Octafluoronaphthalene is typically synthesized through the fluorination of naphthalene using fluorine gas (F2) in the presence of a suitable catalyst, such as trifluoromethylsulfonic acid (CF3SO3H). The reaction is carried out under anhydrous conditions and requires careful temperature control to achieve high yields and selectivity.

About

CAS No 313-72-4
English Name Octafluoronaphthalene
Molecular Formula C10F8
Molecular Weight 272.09 g/mol
SMILES C12=C(C(=C(C(=C1F)F)F)F)C(=C(C(=C2F)F)F)F
InChIKey JDCMOHAFGDQQJX-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Octafluoronaphthalene (CAS: 313-72-4)?

Octafluoronaphthalene (CAS: 313-72-4) is a stable, colorless crystalline solid with a high melting p...

Compound Q&A

What industries use Octafluoronaphthalene (CAS: 313-72-4)?

Octafluoronaphthalene (CAS: 313-72-4) is used in various industries, including pharmaceuticals for t...

Compound Q&A

What precautions should be taken when handling Octafluoronaphthalene (CAS: 313-72-4)?

When handling Octafluoronaphthalene (CAS: 313-72-4), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...