Compound Q&A

What precautions should be taken when handling Sulfachloropyridazine (CAS: 80-32-0)?

Answer

Sulfachloropyridazine
When handling Sulfachloropyridazine (CAS: 80-32-0), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be managed using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for specific guidelines on disposal and emergency procedures.

About

CAS No 80-32-0
English Name Sulfachloropyridazine
Molecular Formula C10H9ClN4O2S
Molecular Weight 284.73 g/mol
SMILES C1=CC(=CC=C1N)S(=O)(=O)NC2=NN=C(C=C2)Cl
InChIKey XOXHILFPRYWFOD-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sulfachloropyridazine (CAS: 80-32-0)?

Sulfachloropyridazine (CAS: 80-32-0) is a white to pale yellow crystalline solid with a molecular we...

Compound Q&A

How is Sulfachloropyridazine (CAS: 80-32-0) typically synthesized?

Sulfachloropyridazine (CAS: 80-32-0) is typically synthesized via a multi-step process starting with...

Compound Q&A

What industries use Sulfachloropyridazine (CAS: 80-32-0)?

Sulfachloropyridazine (CAS: 80-32-0) is primarily used in the pharmaceutical industry for the produc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...