Compound Q&A

What are the physical and chemical properties of Sulfachloropyridazine (CAS: 80-32-0)?

Answer

Sulfachloropyridazine
Sulfachloropyridazine (CAS: 80-32-0) is a white to pale yellow crystalline solid with a molecular weight of approximately 266.77 g/mol. It is slightly soluble in water but more soluble in organic solvents. Chemically, it is relatively stable under normal conditions but can react with strong reducing agents. Its solubility and reactivity make it suitable for various applications in pharmaceuticals and agriculture.

About

CAS No 80-32-0
English Name Sulfachloropyridazine
Molecular Formula C10H9ClN4O2S
Molecular Weight 284.73 g/mol
SMILES C1=CC(=CC=C1N)S(=O)(=O)NC2=NN=C(C=C2)Cl
InChIKey XOXHILFPRYWFOD-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Sulfachloropyridazine (CAS: 80-32-0) typically synthesized?

Sulfachloropyridazine (CAS: 80-32-0) is typically synthesized via a multi-step process starting with...

Compound Q&A

What industries use Sulfachloropyridazine (CAS: 80-32-0)?

Sulfachloropyridazine (CAS: 80-32-0) is primarily used in the pharmaceutical industry for the produc...

Compound Q&A

What precautions should be taken when handling Sulfachloropyridazine (CAS: 80-32-0)?

When handling Sulfachloropyridazine (CAS: 80-32-0), it is crucial to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...