Compound Q&A

What are the physical and chemical properties of 2,6-Dibromo-4-(trifluoromethoxy)aniline (CAS: 88149-49-9)?

Answer

2,6-Dibromo-4-(trifluoromethoxy)aniline
2,6-Dibromo-4-(trifluoromethoxy)aniline is a crystalline compound with a molecular weight of approximately 434.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetonitrile. It is moderately reactive, particularly towards nucleophiles and reducing agents. The compound shows good stability under normal conditions but its reactivity can increase under certain conditions such as high temperature or in the presence of moisture.

About

CAS No 88149-49-9
English Name 2,6-Dibromo-4-(trifluoromethoxy)aniline
Molecular Formula C7H4Br2F3NO
Molecular Weight 334.92 g/mol
SMILES C1=C(C=C(C(=C1Br)N)Br)OC(F)(F)F
InChIKey JBSWOEGXMADXOU-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2,6-Dibromo-4-(trifluoromethoxy)aniline (CAS: 88149-49-9) typically synthesized?

2,6-Dibromo-4-(trifluoromethoxy)aniline is typically synthesized through the reaction of 2,6-dibromo...

Compound Q&A

What industries use 2,6-Dibromo-4-(trifluoromethoxy)aniline (CAS: 88149-49-9)?

2,6-Dibromo-4-(trifluoromethoxy)aniline is utilized in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling 2,6-Dibromo-4-(trifluoromethoxy)aniline (CAS: 88149-49-9)?

When handling 2,6-Dibromo-4-(trifluoromethoxy)aniline, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...