Compound Q&A

What precautions should be taken when handling 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

Answer

4-Hydrazinobenzenesulfonic acid
When handling 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5), it is crucial to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials, and the area should be flushed with water. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 98-71-5
English Name 4-Hydrazinobenzenesulfonic acid
Molecular Formula C6H8N2O3S
Molecular Weight 188.21 g/mol
SMILES C1=CC(=CC=C1NN)S(=O)(=O)O
InChIKey IOMZCWUHFGMSEJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) typically synthesized?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is typically synthesized by the reaction of benzenesu...

Compound Q&A

What industries use 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is utilized in the pharmaceutical industry for the sy...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...