Compound Q&A

How is 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) typically synthesized?

Answer

4-Hydrazinobenzenesulfonic acid
4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is typically synthesized by the reaction of benzenesulfonic acid with hydrazine hydrate. The reaction is carried out in an aqueous medium and involves the nucleophilic substitution of the sulfonic acid group by the hydrazine moiety. Commonly, concentrated sulfuric acid is used as a catalyst to increase the reaction rate and yield.

About

CAS No 98-71-5
English Name 4-Hydrazinobenzenesulfonic acid
Molecular Formula C6H8N2O3S
Molecular Weight 188.21 g/mol
SMILES C1=CC(=CC=C1NN)S(=O)(=O)O
InChIKey IOMZCWUHFGMSEJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is utilized in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

When handling 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...