Compound Q&A

What are the physical and chemical properties of 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

Answer

4-Hydrazinobenzenesulfonic acid
4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is a crystalline solid with a molecular weight of approximately 213.14 g/mol. It has a solubility of about 1 g/L in water. This compound is known for its reducing properties and acts as a weak acid. It is highly reactive in acidic media and can undergo substitution reactions.

About

CAS No 98-71-5
English Name 4-Hydrazinobenzenesulfonic acid
Molecular Formula C6H8N2O3S
Molecular Weight 188.21 g/mol
SMILES C1=CC(=CC=C1NN)S(=O)(=O)O
InChIKey IOMZCWUHFGMSEJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) typically synthesized?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is typically synthesized by the reaction of benzenesu...

Compound Q&A

What industries use 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5) is utilized in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5)?

When handling 4-Hydrazinobenzenesulfonic acid (CAS: 98-71-5), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...