Compound Q&A

What precautions should be taken when handling Isoconazole nitrate (CAS: 24168-96-5)?

Answer

Isoconazole nitrate
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn when handling Isoconazole nitrate (CAS: 24168-96-5). Work should be conducted in a fume hood due to its potential volatility. Spills should be cleaned up carefully, following standard safety procedures, and the material safety data sheet (SDS) should be consulted for detailed instructions.

About

CAS No 24168-96-5
English Name Isoconazole nitrate
Molecular Formula C18H15Cl4N3O4
Molecular Weight 479.1 g/mol
SMILES C1=CC(=C(C(=C1)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-]
InChIKey NNGQLSIGRSTLLU-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isoconazole nitrate (CAS: 24168-96-5)?

Isoconazole nitrate (CAS: 24168-96-5) is a white crystalline compound with a molecular weight of app...

Compound Q&A

How is Isoconazole nitrate (CAS: 24168-96-5) typically synthesized?

Isoconazole nitrate is typically synthesized by reacting isoconazole with nitric acid. The reaction ...

Compound Q&A

What industries use Isoconazole nitrate (CAS: 24168-96-5)?

Isoconazole nitrate (CAS: 24168-96-5) is primarily used in the pharmaceutical industry as an antifun...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...