Compound Q&A

What industries use Isoconazole nitrate (CAS: 24168-96-5)?

Answer

Isoconazole nitrate
Isoconazole nitrate (CAS: 24168-96-5) is primarily used in the pharmaceutical industry as an antifungal agent. It is also used in some agricultural applications as a fungicide. Additionally, it has limited use in the chemical industry for synthesis of other compounds.

About

CAS No 24168-96-5
English Name Isoconazole nitrate
Molecular Formula C18H15Cl4N3O4
Molecular Weight 479.1 g/mol
SMILES C1=CC(=C(C(=C1)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-]
InChIKey NNGQLSIGRSTLLU-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isoconazole nitrate (CAS: 24168-96-5)?

Isoconazole nitrate (CAS: 24168-96-5) is a white crystalline compound with a molecular weight of app...

Compound Q&A

How is Isoconazole nitrate (CAS: 24168-96-5) typically synthesized?

Isoconazole nitrate is typically synthesized by reacting isoconazole with nitric acid. The reaction ...

Compound Q&A

What precautions should be taken when handling Isoconazole nitrate (CAS: 24168-96-5)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...