Compound Q&A

What are the physical and chemical properties of Isoconazole nitrate (CAS: 24168-96-5)?

Answer

Isoconazole nitrate
Isoconazole nitrate (CAS: 24168-96-5) is a white crystalline compound with a molecular weight of approximately 314.13 g/mol. It has good solubility in water and organic solvents. Isoconazole nitrate is relatively stable under normal conditions but may decompose upon heating. It reacts well with bases and can form complexes with metal ions.

About

CAS No 24168-96-5
English Name Isoconazole nitrate
Molecular Formula C18H15Cl4N3O4
Molecular Weight 479.1 g/mol
SMILES C1=CC(=C(C(=C1)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-]
InChIKey NNGQLSIGRSTLLU-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Isoconazole nitrate (CAS: 24168-96-5) typically synthesized?

Isoconazole nitrate is typically synthesized by reacting isoconazole with nitric acid. The reaction ...

Compound Q&A

What industries use Isoconazole nitrate (CAS: 24168-96-5)?

Isoconazole nitrate (CAS: 24168-96-5) is primarily used in the pharmaceutical industry as an antifun...

Compound Q&A

What precautions should be taken when handling Isoconazole nitrate (CAS: 24168-96-5)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...