Compound Q&A

What industries use hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

Answer

ammonia; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum
Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) is used in the pharmaceutical industry for synthesizing complex molybdenum-based compounds. It also finds applications in semiconductor manufacturing, where its catalytic properties are utilized in the production of advanced materials. Additionally, it is used in the development of novel sensors and in the preparation of new materials for polymer science.

About

CAS No 27546-07-2
English Name ammonia; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum
Molecular Formula H8Mo2N2O7
Molecular Weight 339.95 g/mol
SMILES N.N.O[Mo](=O)(=O)O[Mo](=O)(=O)O
InChIKey XUFUCDNVOXXQQC-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) is a crystalline compound w...

Compound Q&A

How is hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) typically synthesized?

Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum is typically synthesized through the condensa...

Compound Q&A

What precautions should be taken when handling hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

When handling hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...