Compound Q&A

How is hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) typically synthesized?

Answer

ammonia; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum
Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum is typically synthesized through the condensation of molybdenum oxoacids with hydroxyl groups. This process involves the use of molybdenum(III) or molybdenum(IV) oxoacids as starting materials and requires careful control of pH and temperature to achieve the desired yield and product selectivity.

About

CAS No 27546-07-2
English Name ammonia; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum
Molecular Formula H8Mo2N2O7
Molecular Weight 339.95 g/mol
SMILES N.N.O[Mo](=O)(=O)O[Mo](=O)(=O)O
InChIKey XUFUCDNVOXXQQC-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) is a crystalline compound w...

Compound Q&A

What industries use hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) is used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

When handling hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...