Compound Q&A

What are the physical and chemical properties of hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

Answer

ammonia; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum
Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) is a crystalline compound with a high molecular weight. It has a low solubility in water and is highly reactive, particularly under acidic conditions. This compound is known for its catalytic properties in various chemical reactions and its role as a molybdenum-based catalyst.

About

CAS No 27546-07-2
English Name ammonia; hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum
Molecular Formula H8Mo2N2O7
Molecular Weight 339.95 g/mol
SMILES N.N.O[Mo](=O)(=O)O[Mo](=O)(=O)O
InChIKey XUFUCDNVOXXQQC-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) typically synthesized?

Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum is typically synthesized through the condensa...

Compound Q&A

What industries use hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

Hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2) is used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2)?

When handling hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxo-molybdenum (CAS: 27546-07-2), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...